Systematic / IUPAC Name: (3S)-3-(4-Hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol
ID: Reference5832
Other Names:
(-)-(S)-Equol;
(-)-Equol;
(S)-(-)-4',7-Isoflavandiol;
4',7-Isoflavandiol;
Equol
; more
Formula: C15H14O3
Class: Endogenous Metabolites
(S)-Equol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 892 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/26/2016 11:30:51 AM |
| InChI | InChI=1S/C15H14O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-6,8,12,16-17H,7,9H2/t12-/m1/s1 |
| InChI Key | ADFCQWZHKCXPAJ-GFCCVEGCSA-N |
| Canonical SMILES | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O |
| CAS | 531953 |
| Splash | |
| Other Names |
(-)-(S)-Equol; (-)-Equol; (S)-(-)-4',7-Isoflavandiol; 4',7-Isoflavandiol; Equol; (S)-3-(4-Hydroxyphenyl)chroman-7-ol; (S)-3,4-Dihydro-3-(4-hydroxyphenyl)-2H-1-benzopyran-7-ol; (3S)-3-(4-Hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-7-ol; (3S)-3-(4-Hydroxyphenyl)chroman-7-ol; 3,4-Dihydro-3-(4-hydroxyphenyl)-(S)-2H-1-benzopyran-7-ol; 4',7-Dihydroxyisoflavan; 7-Hydroxy-3-(4'-hydroxyphenyl)chroman |
| ChEBI | CHEBI:34741 |
| HMDb | HMDB02209 |
| ChemSpider | 82594 |
| Wikipedia | Equol |
| ChEMBL | CHEMBL198877 |
| PubChem | 91469 |
| KEGG | C14131 |
| ChemIDPlus | 000531953 |