Systematic / IUPAC Name: 4-Amino-3-(4-chlorophenyl)butanoic acid
ID: Reference585
Other Names:
β-(4-Chlorophenyl)gaba;
β-(Aminomethyl)-4-chlorobenzenepropanoic acid;
4-Amino-3-(4-chlorophenyl)butyric acid;
β-(Aminomethyl)-p-chlorohydrocinnamic acid;
β-(p-Chlorophenyl)-Υ-aminobutyric acid
; more
Formula: C10H12ClNO2
Class: Therapeutics/Prescription Drugs
Baclofen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 87 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/10/2015 9:31:36 AM |
| InChI | InChI=1S/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14) |
| InChI Key | KPYSYYIEGFHWSV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)Cl |
| CAS | 1134470 |
| Splash | |
| Other Names |
β-(4-Chlorophenyl)gaba; β-(Aminomethyl)-4-chlorobenzenepropanoic acid; 4-Amino-3-(4-chlorophenyl)butyric acid; β-(Aminomethyl)-p-chlorohydrocinnamic acid; β-(p-Chlorophenyl)-Υ-aminobutyric acid; DL-4-Amino-3-p-chlorophenylbutanoic acid; Benzenepropanoic acid, β-(aminomethyl)-4-chloro-; Υ-Amino-β-(p-chlorophenyl)butyric acid; Hydrocinnamic acid, β-(aminomethyl)-p-chloro-; Lioresal; Baclon; Kemstro; DL-Baclofen; Atrofen; Baclophen; Gabalon; Clofen; Baclospas; Genpharm; Apobaclofen; Lebic; Nubaclo; M-Baclo; (RS)-Baclofen; Baclofen (RS)- |