Systematic / IUPAC Name: (3S,3'S)-3,3'-Dihydroxy-β,β-carotene-4,4'-dione
ID: Reference5854
Other Names:
(3S,3'S)-All-trans-astaxanthin;
(3S,3'S)-Astaxanthin;
trans-Astaxanthin;
All-trans-astaxanthin;
AXT
; more
Formula: C40H52O4
Class: Endogenous Metabolites
Astaxanthin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 692 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/27/2016 12:28:51 PM |
| InChI | InChI=1S/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+/t35-,36-/m0/s1 |
| InChI Key | MQZIGYBFDRPAKN-UWFIBFSHSA-N |
| Canonical SMILES | CC1=C(C(CC(C1=O)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(C(=O)C(CC2(C)C)O)C)C)C |
| CAS | 472617 |
| Splash | |
| Other Names |
(3S,3'S)-All-trans-astaxanthin; (3S,3'S)-Astaxanthin; trans-Astaxanthin; All-trans-astaxanthin; AXT; Coriolus versicolor extract; Lucantin pink; Natupink; Ovoester; β,β-Carotene-4,4'-dione, 3,3'-dihydroxy-, (3S,3'S)-; (6S)-6-Hydroxy-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4S)-4-hydroxy-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one; (6S,6'S)-3,3'-((1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-Tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaene-1,18-diyl)bis(6-hydroxy-2,4,4-trimethylcyclohex-2-en-1-one); AstaREAL ; AstaXin ; BioAstin ; Carophyll Pink ; Lucantin Pink ; NatuRose |
| ChemSpider | 4444636 |
| HMDb | HMDB02204 |
| Wikipedia | Astaxanthin |
| ChEMBL | CHEMBL1255871 |
| PubChem | 5281224 |
| KEGG | C08580 |
| ChEBI | CHEBI:40968 |