Systematic / IUPAC Name: [4-({6-[Allyl(methyl)amino]hexyl}oxy)-2-fluorophenyl](4-bromophenyl)methanone
ID: Reference5859
Other Names:
(4-Bromophenyl)[2-fluoro-4-({6-[methyl(prop-2-en-1-yl)amino]hexyl}oxy)phenyl]methanone;
(4-Bromophenyl)-{2-fluoro-4-[6-(methyl-prop-2-enylamino)hexoxy]phenyl}methanone ;
Methanone, (4-bromophenyl)(2-fluoro-4-{[6-(methyl-2-propenylamino)hexyl]oxy}phenyl)-
Formula: C23H27BrFNO2
Ro 48-8071 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/31/2016 8:11:25 AM |
| InChI | InChI=1S/C23H27BrFNO2/c1-3-14-26(2)15-6-4-5-7-16-28-20-12-13-21(22(25)17-20)23(27)18-8-10-19(24)11-9-18/h3,8-13,17H,1,4-7,14-16H2,2H3 |
| InChI Key | CMYCCJYVZIMDFU-UHFFFAOYSA-N |
| Canonical SMILES | CN(CCCCCCOC1=CC(=C(C=C1)C(=O)C2=CC=C(C=C2)Br)F)CC=C |
| CAS | 161582112 |
| Splash | |
| Other Names |
(4-Bromophenyl)[2-fluoro-4-({6-[methyl(prop-2-en-1-yl)amino]hexyl}oxy)phenyl]methanone; (4-Bromophenyl)-{2-fluoro-4-[6-(methyl-prop-2-enylamino)hexoxy]phenyl}methanone ; Methanone, (4-bromophenyl)(2-fluoro-4-{[6-(methyl-2-propenylamino)hexyl]oxy}phenyl)- |
| PubChem | 1949 |
| ChEBI | CHEBI:101064 |
| ChemIDPlus | 161582112; 189197691 |
| ChEMBL | CHEMBL304858 |
| ChemSpider | 1873 |
| DrugBank | DB02016 |