Systematic / IUPAC Name: (5S,8S,9R)-8-Benzoyl-2-[(1S,2S,3Z)-1,2-dihydroxy-3-hexen-1-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione
ID: Reference5860
Other Names:
Pseurotin;
NSC 348694
Formula: C22H25NO8
Class: Endogenous Metabolites
Pseurotin A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/31/2016 8:20:40 AM |
| InChI | InChI=1S/C22H25NO8/c1-4-5-11-14(24)15(25)16-12(2)17(26)21(31-16)19(28)22(30-3,23-20(21)29)18(27)13-9-7-6-8-10-13/h5-11,14-15,19,24-25,28H,4H2,1-3H3,(H,23,29)/b11-5-/t14-,15-,19+,21+,22+/m0/s1 |
| InChI Key | SLYDIPAXCVVRNY-UOWMTANKSA-N |
| Canonical SMILES | CCC=CC(C(C1=C(C(=O)C2(O1)C(C(NC2=O)(C(=O)C3=CC=CC=C3)OC)O)C)O)O |
| CAS | 58523301 |
| Splash | |
| Other Names |
Pseurotin; NSC 348694 |
| Wikipedia | Pseurotin A |
| PubChem | 9845622 |
| ChEBI | CHEBI:64535 |
| ChEMBL | CHEMBL253179 |
| ChemSpider | 8021336 |