Systematic / IUPAC Name: (5Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-{(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl}cyclopentyl]-5-heptenoic acid
ID: Reference5875
Other Names:
(+)-Fluprostenol;
Fluprostenol, (+)-;
Fluprostenolum;
Travoprost acid;
Travoprost free acid
; more
Formula: C23H29F3O6
Class: Endogenous Metabolites
Fluprostenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/1/2016 11:12:16 AM |
| InChI | InChI=1S/C23H29F3O6/c24-23(25,26)15-6-5-7-17(12-15)32-14-16(27)10-11-19-18(20(28)13-21(19)29)8-3-1-2-4-9-22(30)31/h1,3,5-7,10-12,16,18-21,27-29H,2,4,8-9,13-14H2,(H,30,31)/b3-1-,11-10+/t16-,18-,19-,20+,21-/m1/s1 |
| InChI Key | WWSWYXNVCBLWNZ-QIZQQNKQSA-N |
| Canonical SMILES | C1C(C(C(C1O)C=CC(COC2=CC=CC(=C2)C(F)(F)F)O)CC=CCCCC(=O)O)O |
| CAS | 54276174 |
| Splash | |
| Other Names |
(+)-Fluprostenol; Fluprostenol, (+)-; Fluprostenolum; Travoprost acid; Travoprost free acid; (Z)-7-((1R,2R,3R,5S)-3,5-Dihydroxy-2-{(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl}cyclopentyl)hept-5-enoic acid ; (5Z)-7-((1R,2R,3R,5S)-3,5-Dihydroxy-2-{(1E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-en-1-yl}cyclopentyl)hept-5-enoic acid ; 16-m-Trifluoromethylphenoxy tetranorprostaglandin F2α ; 9α,11α,15R-Trihydroxy-16-[3-(trifluoromethyl)phenoxy]-17,18,19,20-tetranor-prosta-5Z,13E-dien-1-oic acid |
| KEGG | D02728 |
| PubChem | 5311100 |
| ChEMBL | CHEMBL1201379 |
| ChEBI | CHEBI:60782 |
| ChemSpider | 4470630 |