Systematic / IUPAC Name: 2-(4-{2-[(4-Chlorobenzoyl)amino]ethyl}phenoxy)-2-methylpropanoic acid
ID: Reference588
Other Names:
Propanoic acid, 2-(4-(2-((4-chlorobenzoyl)amino)ethyl)phenoxy)-2-methyl-;
2-[4-[2-[(4-Chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid;
a-[4-(4-Chlorobenzoylaminoethyl)phenoxy]isobutyric acid;
Propanoic acid, 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methyl-;
2-[p-[2-p-Chlorobenzamido)ethyl]phenoxy]-2-methylpropionic acid
; more
Formula: C19H20ClNO4
Class: Therapeutics/Prescription Drugs
Benzafibrate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 449 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/10/2015 10:42:30 AM |
| InChI | InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChI Key | IIBYAHWJQTYFKB-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |
| CAS | 41859670 |
| Splash | |
| Other Names |
Propanoic acid, 2-(4-(2-((4-chlorobenzoyl)amino)ethyl)phenoxy)-2-methyl-; 2-[4-[2-[(4-Chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid; a-[4-(4-Chlorobenzoylaminoethyl)phenoxy]isobutyric acid; Propanoic acid, 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methyl-; 2-[p-[2-p-Chlorobenzamido)ethyl]phenoxy]-2-methylpropionic acid; Bezafibrate; Bezalip; Cedur; Befizal; Bezafibrat; Durabezur; Sklerofibrat; Azufibrat; Bezabeta; Bezacur; Bezamerck; Bezatol; Difaterol; Eulitop; Reducterol; Solibay; Lipox; Bezalip retard; Bezafibrat PB; Regadrin B; Befibrat; Bezafisal; Bezalande; Bezapuren |
| ChEBI | CHEBI:47612 |
| PubChem | 39042 |
| Wikipedia | Bezafibrate |
| ChemSpider | 35728; 21239568 |
| ChEMBL | CHEMBL264374 |
| HMDb | HMDB15465 |
| ChemIDPlus | 041859670 |
| KEGG | D01366 |