Systematic / IUPAC Name: (1S,12S,16R,17R)-17-(Hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.0~1,13~ 0~4,12~ 0~5,9~]nonadeca-5(9),6,10-trien-17-ol
ID: Reference5891
Other Names: 3bS,4,5,6,7R,8R,9,10,10aR,10bS-Decahydro-7-hydroxy-10b-methyl-5aS,8-methano-5aH-cyclohepta[5,6]naphtho[2,1-b]furan-7-methanol
Formula: C20H26O3
Class: Endogenous Metabolites
Kahweol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/3/2016 9:26:05 AM |
| InChI | InChI=1S/C20H26O3/c1-18-7-5-16-14(6-9-23-16)15(18)4-8-19-10-13(2-3-17(18)19)20(22,11-19)12-21/h5-7,9,13,15,17,21-22H,2-4,8,10-12H2,1H3/t13-,15?,17?,18-,19+,20+/m1/s1 |
| InChI Key | JEKMKNDURXDJAD-JUKDXYPLSA-N |
| Canonical SMILES | CC12C=CC3=C(C1CCC45C2CCC(C4)C(C5)(CO)O)C=CO3 |
| CAS | 6894435 |
| Splash | |
| Other Names | 3bS,4,5,6,7R,8R,9,10,10aR,10bS-Decahydro-7-hydroxy-10b-methyl-5aS,8-methano-5aH-cyclohepta[5,6]naphtho[2,1-b]furan-7-methanol |
| ChEMBL | CHEMBL1593983 |
| ChemSpider | 13082889 |
| Wikipedia | Kahweol |
| PubChem | 15940202 |