Systematic / IUPAC Name: 3-[1-(Cyclohexylmethyl)-1H-indazole-3-carboxamido]-2,2-dimethylsuccinic acid
ID: Reference5896
Other Names: ADB-CHMINACA metabolite M7
Formula: C21H27N3O5
Class: Drugs of Abuse/Illegal Drugs
MAB-CHMINACA metabolite M7 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 428 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2017 7:37:03 AM |
| InChI | 1S/C21H27N3O5/c1-21(2,20(28)29)17(19(26)27)22-18(25)16-14-10-6-7-11-15(14)24(23-16)12-13-8-4-3-5-9-13/h6-7,10-11,13,17H,3-5,8-9,12H2,1-2H3,(H,22,25)(H,26,27)(H,28,29) |
| InChI Key | XOHVSBZMRVJHQW-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC(C(O)=O)C(C)(C)C(O)=O)C1=NN(CC2CCCCC2)C3=C1C=CC=C3 |
| CAS | |
| Splash | |
| Other Names | ADB-CHMINACA metabolite M7 |