Systematic / IUPAC Name: N-Phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]acrylamide
ID: Reference5902
Other Names: 2-Propenamide, N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]-
Formula: C22H26N2O
Class: Drugs of Abuse/Illegal Drugs
Acrylfentanyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/4/2016 1:51:42 PM |
| InChI | InChI=1S/C22H26N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h2-12,21H,1,13-18H2 |
| InChI Key | RFQNLMWUIJJEQF-UHFFFAOYSA-N |
| Canonical SMILES | C=CC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 2-Propenamide, N-phenyl-N-[1-(2-phenylethyl)-4-piperidinyl]- |
| ChEMBL | CHEMBL1196205 |
| PubChem | 10314851 |
| ChemSpider | 8490316 |
| Wikipedia | Acrylfentanyl |