Systematic / IUPAC Name: 1-(2-Fluoropentyl)-N-(naphthalen-1-yl)-1H-indole-3-carboxamide
ID: Reference5905
Other Names: 2-Fluoro MN-24
Formula: C24H23FN2O
Class: Drugs of Abuse/Illegal Drugs
2-Fluoro NNEI mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 207 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/7/2016 10:44:25 AM |
| InChI | 1S/C24H23FN2O/c1-2-8-18(25)15-27-16-21(20-12-5-6-14-23(20)27)24(28)26-22-13-7-10-17-9-3-4-11-19(17)22/h3-7,9-14,16,18H,2,8,15H2,1H3,(H,26,28) |
| InChI Key | HSKUHSPFXOBHMD-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1=CN(CC(F)CCC)C2=C1C=CC=C2)NC3=C(C=CC=C4)C4=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 2-Fluoro MN-24 |