Systematic / IUPAC Name: Methyl [1-(4-fluoropentyl)-1H-indazole-3-carbonyl]-L-valinate
ID: Reference5908
Other Names: 4-Fluoro AMP
Formula: C19H26FN3O3
Class: Drugs of Abuse/Illegal Drugs
4-Fluoro AMB mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/7/2016 12:11:58 PM |
| InChI | 1S/C19H26FN3O3/c1-12(2)16(19(25)26-4)21-18(24)17-14-9-5-6-10-15(14)23(22-17)11-7-8-13(3)20/h5-6,9-10,12-13,16H,7-8,11H2,1-4H3,(H,21,24)/t13?,16-/m0/s1 |
| InChI Key | LALXOELXNROCJM-VYIIXAMBSA-N |
| Canonical SMILES | O=C(N[C@H](C(OC)=O)C(C)C)C1=NN(CCCC(F)C)C2=C1C=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 4-Fluoro AMP |