Systematic / IUPAC Name: Methyl (2S)-(4-fluorophenyl)[(2S)-2-piperidinyl]acetate
ID: Reference5910
Other Names: 2-Piperidineacetic acid, α-(4-fluorophenyl)-, methyl ester, (αS,2S)-
Formula: C14H18FNO2
Class: Drugs of Abuse/Illegal Drugs
(+/-)-threo-4-Fluoromethylphenidate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/7/2016 1:43:45 PM |
| InChI | InChI=1S/C14H18FNO2/c1-18-14(17)13(12-4-2-3-9-16-12)10-5-7-11(15)8-6-10/h5-8,12-13,16H,2-4,9H2,1H3/t12-,13-/m0/s1 |
| InChI Key | XISBAJBPDVRSPG-STQMWFEESA-N |
| Canonical SMILES | COC(=O)C(C1CCCCN1)C2=CC=C(C=C2)F |
| CAS | |
| Splash | |
| Other Names | 2-Piperidineacetic acid, α-(4-fluorophenyl)-, methyl ester, (αS,2S)- |
| ChEMBL | CHEMBL1194927 |
| Wikipedia | 4-Fluoromethylphenidate |
| PubChem | 10753242 |
| ChemSpider | 8928565 |