Systematic / IUPAC Name: 2-(Methylamino)-2-phenylcyclohexanone
ID: Reference5915
Other Names:
2'-Oxo-PCM ;
2-(Methylamino)-2-phenylcyclohexan-1-one;
Cyclohexanone, 2-(methylamino)-2-phenyl-
Formula: C13H17NO
Class: Drugs of Abuse/Illegal Drugs
Deschloroketamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/7/2016 2:54:13 PM |
| InChI | InChI=1S/C13H17NO/c1-14-13(10-6-5-9-12(13)15)11-7-3-2-4-8-11/h2-4,7-8,14H,5-6,9-10H2,1H3 |
| InChI Key | ZAGBSZSITDFFAF-UHFFFAOYSA-N |
| Canonical SMILES | CNC1(CCCCC1=O)C2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
2'-Oxo-PCM ; 2-(Methylamino)-2-phenylcyclohexan-1-one; Cyclohexanone, 2-(methylamino)-2-phenyl- |
| Wikipedia | Deschloroketamine |
| ChemSpider | 386687 |
| PubChem | 437168 |
| ChEMBL | CHEMBL2068808 |