Systematic / IUPAC Name: 4-(Adamantan-1-ylsulfinyl)morpholine
ID: Reference5937
Other Names: 4-(Tricyclo[3.3.1.13,7]dec-1-ylsulfinyl)morpholine
Formula: C14H23NO2S
4-(1-Adamantylsulfinyl)morpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/9/2016 11:36:16 AM |
| InChI | InChI=1S/C14H23NO2S/c16-18(15-1-3-17-4-2-15)14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13H,1-10H2 |
| InChI Key | ITCBAGHZONQICL-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1S(=O)C23CC4CC(C2)CC(C4)C3 |
| CAS | |
| Splash | |
| Other Names | 4-(Tricyclo[3.3.1.13,7]dec-1-ylsulfinyl)morpholine |