Systematic / IUPAC Name: N2-{[1-(Cyclohexylmethyl)-1H-indazol-3-yl]carbonyl}-3-methyl-α-asparagine
ID: Reference5940
Other Names: 4-Amino-3-(1-(cyclohexylmethyl)-1H-indazole-3-carboxamido)-2-methyl-4-oxobutanoic acid
Formula: C20H26N4O4
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
AB-CHMINACA metabolite M6 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 3044 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/8/2019 8:12:18 AM |
| InChI | InChI=1S/C20H26N4O4/c1-12(20(27)28)16(18(21)25)22-19(26)17-14-9-5-6-10-15(14)24(23-17)11-13-7-3-2-4-8-13/h5-6,9-10,12-13,16H,2-4,7-8,11H2,1H3,(H2,21,25)(H,22,26)(H,27,28) |
| InChI Key | DQRRHTCQQGYUSD-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC(C(C)C(O)=O)C(N)=O)C1=NN(CC2CCCCC2)C3=C1C=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 4-Amino-3-(1-(cyclohexylmethyl)-1H-indazole-3-carboxamido)-2-methyl-4-oxobutanoic acid |
| ChemSpider | 32741706 |