Systematic / IUPAC Name: 3-Amino-2-(pyrrolidine-1-carbonyl)quinazolin-4-one
ID: Reference5944
Other Names: 4(3H)-Quinazolinone, 3-amino-2-(1-pyrrolidinylcarbonyl)-
Formula: C13H14N4O2
3-Amino-2-(1-pyrrolidinylcarbonyl)-4(3H)-quinazolinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2016 7:50:14 AM |
| InChI | InChI=1S/C13H14N4O2/c14-17-11(13(19)16-7-3-4-8-16)15-10-6-2-1-5-9(10)12(17)18/h1-2,5-6H,3-4,7-8,14H2 |
| InChI Key | DGNVTUWXQDITHZ-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(C1)C(=O)C2=NC3=CC=CC=C3C(=O)N2N |
| CAS | |
| Splash | |
| Other Names | 4(3H)-Quinazolinone, 3-amino-2-(1-pyrrolidinylcarbonyl)- |