Systematic / IUPAC Name: Methyl N-[4-(4-chlorophenoxy)phenyl]-N'-(1-phenylethyl)carbamimidothioate
ID: Reference5945
Other Names: Carbamimidothioic acid, N-[4-(4-chlorophenoxy)phenyl]-N'-(1-phenylethyl), methyl ester
Formula: C22H21ClN2OS
Methyl N-(1-phenylethyl)-[4-(4-chlorophenoxy)anilino]methanimidothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2016 7:51:51 AM |
| InChI | InChI=1S/C22H21ClN2OS/c1-16(17-6-4-3-5-7-17)24-22(27-2)25-19-10-14-21(15-11-19)26-20-12-8-18(23)9-13-20/h3-16H,1-2H3,(H,24,25) |
| InChI Key | VFRJJBOPSJFEQQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1=CC=CC=C1)N=C(NC2=CC=C(C=C2)OC3=CC=C(C=C3)Cl)SC |
| CAS | |
| Splash | |
| Other Names | Carbamimidothioic acid, N-[4-(4-chlorophenoxy)phenyl]-N'-(1-phenylethyl), methyl ester |