Systematic / IUPAC Name: (2Z)-2-Cyano-3-(dimethylamino)-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)acrylamide
ID: Reference5953
Other Names: 2-Propenamide, 2-cyano-3-(dimethylamino)-N-(1,3,5-trimethyl-1H-pyrazol-4-yl), (2Z)-
Formula: C12H17N5O
N1-(1,3,5-Trimethyl-1H-pyrazol-4-yl)-2-cyano-3-(dimethylamino)acrylamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2016 9:57:22 AM |
| InChI | InChI=1S/C12H17N5O/c1-8-11(9(2)17(5)15-8)14-12(18)10(6-13)7-16(3)4/h7H,1-5H3,(H,14,18)/b10-7- |
| InChI Key | VHDIKCSEXIRBBX-YFHOEESVSA-N |
| Canonical SMILES | CC1=C(C(=NN1C)C)NC(=O)C(=CN(C)C)C#N |
| CAS | |
| Splash | |
| Other Names | 2-Propenamide, 2-cyano-3-(dimethylamino)-N-(1,3,5-trimethyl-1H-pyrazol-4-yl), (2Z)- |
| PubChem | 2805537 |
| ChemSpider | 2084065 |
| ChEMBL | CHEMBL1421932 |