Systematic / IUPAC Name: [4-(2-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](1-naphthyl)methanone
ID: Reference5954
Other Names:
[4-(2-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone ;
Methanone, [4-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-
Formula: C26H24FNO
Class: Drugs of Abuse/Illegal Drugs
JWH 307 3'-isomer mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2016 9:52:56 AM |
| InChI | InChI=1S/C26H24FNO/c1-2-3-8-16-28-17-23(21-13-6-7-15-25(21)27)24(18-28)26(29)22-14-9-11-19-10-4-5-12-20(19)22/h4-7,9-15,17-18H,2-3,8,16H2,1H3 |
| InChI Key | UYJFMGFYDZRBMH-UHFFFAOYSA-N |
| Canonical SMILES | O=C(C1=CN(CCCCC)C=C1C2=C(F)C=CC=C2)C3=C4C(C=CC=C4)=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
[4-(2-Fluorophenyl)-1-pentyl-1H-pyrrol-3-yl](naphthalen-1-yl)methanone ; Methanone, [4-(2-fluorophenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl- |
| ChemSpider | 34975855 |