Systematic / IUPAC Name: 5-Nitro-2-(phenylsulfanyl)-N-(4-pyridinyl)benzamide
ID: Reference5962
Other Names: Benzamide, 5-nitro-2-(phenylthio)-N-4-pyridinyl-
Formula: C18H13N3O3S
N1-(4-Pyridyl)-5-nitro-2-(phenylthio)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 6:49:42 AM |
| InChI | InChI=1S/C18H13N3O3S/c22-18(20-13-8-10-19-11-9-13)16-12-14(21(23)24)6-7-17(16)25-15-4-2-1-3-5-15/h1-12H,(H,19,20,22) |
| InChI Key | RRBKFKHGHNYIOK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)SC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)NC3=CC=NC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzamide, 5-nitro-2-(phenylthio)-N-4-pyridinyl- |