Systematic / IUPAC Name: N-(Dipropylcarbamothioyl)-3-nitrobenzamide
ID: Reference5968
Other Names:
N'-(3-Nitrobenzoyl)-N,N-dipropylthiourea ;
Benzamide, N-[(dipropylamino)thioxomethyl]-3-nitro-
Formula: C14H19N3O3S
N'-(3-Nitrobenzoyl)-N,N-dipropylthiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 8:36:37 AM |
| InChI | InChI=1S/C14H19N3O3S/c1-3-8-16(9-4-2)14(21)15-13(18)11-6-5-7-12(10-11)17(19)20/h5-7,10H,3-4,8-9H2,1-2H3,(H,15,18,21) |
| InChI Key | OXJNQSUAEPCFJY-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
N'-(3-Nitrobenzoyl)-N,N-dipropylthiourea ; Benzamide, N-[(dipropylamino)thioxomethyl]-3-nitro- |