Systematic / IUPAC Name: Ethyl [4-(5-nitro-2-pyridinyl)-1-piperazinyl]acetate
ID: Reference5970
Other Names:
Ethyl 2-[4-(5-nitropyridin-2-yl)piperazin-1-yl]acetate;
1-Piperazineacetic acid, 4-(5-nitro-2-pyridinyl)-, ethyl ester
Formula: C13H18N4O4
Ethyl 2-[4-(5-nitropyridin-2-yl)piperazino]acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 8:42:31 AM |
| InChI | InChI=1S/C13H18N4O4/c1-2-21-13(18)10-15-5-7-16(8-6-15)12-4-3-11(9-14-12)17(19)20/h3-4,9H,2,5-8,10H2,1H3 |
| InChI Key | HFSXLOQAOHKFLL-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
Ethyl 2-[4-(5-nitropyridin-2-yl)piperazin-1-yl]acetate; 1-Piperazineacetic acid, 4-(5-nitro-2-pyridinyl)-, ethyl ester |