Systematic / IUPAC Name: 3-[[1-[(2-Chloro-6-fluorophenyl)methyl]piperidin-4-yl]carbamoyl]pyrazine-2-carboxylic acid
ID: Reference5974
Other Names: 2-Pyrazinecarboxylic acid, 3-[({1-[(2-chloro-6-fluorophenyl)methyl]-4-piperidinyl}amino)carbonyl]-
Formula: C18H18ClFN4O3
3-({[1-(2-Chloro-6-fluorobenzyl)-4-piperidinyl]amino}carbonyl)-2-pyrazinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 9:03:37 AM |
| InChI | InChI=1S/C18H18ClFN4O3/c19-13-2-1-3-14(20)12(13)10-24-8-4-11(5-9-24)23-17(25)15-16(18(26)27)22-7-6-21-15/h1-3,6-7,11H,4-5,8-10H2,(H,23,25)(H,26,27) |
| InChI Key | IABVHGADHWPHGH-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1NC(=O)C2=NC=CN=C2C(=O)O)CC3=C(C=CC=C3Cl)F |
| CAS | |
| Splash | |
| Other Names | 2-Pyrazinecarboxylic acid, 3-[({1-[(2-chloro-6-fluorophenyl)methyl]-4-piperidinyl}amino)carbonyl]- |