Systematic / IUPAC Name: 2-[2-(1,3-Benzodioxol-5-ylmethylamino)-2-oxoethyl]sulfanylacetic acid
ID: Reference5976
Other Names:
({2-[(1,3-Benzodioxol-5-ylmethyl)amino]-2-oxoethyl}sulfanyl)acetic acid;
2-({[(2H-1,3-Benzodioxol-5-ylmethyl)carbamoyl]methyl}sulfanyl)acetic acid;
Acetic acid, 2-({2-[(1,3-benzodioxol-5-ylmethyl)amino]-2-oxoethyl}thio)-
Formula: C12H13NO5S
2-({2-[(1,3-Benzodioxol-5-ylmethyl)amino]-2-oxoethyl}sulfanyl)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 9:13:21 AM |
| InChI | InChI=1S/C12H13NO5S/c14-11(5-19-6-12(15)16)13-4-8-1-2-9-10(3-8)18-7-17-9/h1-3H,4-7H2,(H,13,14)(H,15,16) |
| InChI Key | JFPVLTFNFLIBDA-UHFFFAOYSA-N |
| Canonical SMILES | C1OC2=C(O1)C=C(C=C2)CNC(=O)CSCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
({2-[(1,3-Benzodioxol-5-ylmethyl)amino]-2-oxoethyl}sulfanyl)acetic acid; 2-({[(2H-1,3-Benzodioxol-5-ylmethyl)carbamoyl]methyl}sulfanyl)acetic acid; Acetic acid, 2-({2-[(1,3-benzodioxol-5-ylmethyl)amino]-2-oxoethyl}thio)- |