Systematic / IUPAC Name: 4-(3-Cyanopyridin-2-yl)-N-(4-phenylmethoxyphenyl)piperazine-1-carboxamide
ID: Reference5986
Other Names: 1-Piperazinecarboxamide, 4-(3-cyano-2-pyridinyl)-N-[4-(phenylmethoxy)phenyl]-
Formula: C24H23N5O2
N-[4-(Benzyloxy)phenyl]-4-(3-cyano-2-pyridinyl)tetrahydro-1(2H)-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 9:55:26 AM |
| InChI | InChI=1S/C24H23N5O2/c25-17-20-7-4-12-26-23(20)28-13-15-29(16-14-28)24(30)27-21-8-10-22(11-9-21)31-18-19-5-2-1-3-6-19/h1-12H,13-16,18H2,(H,27,30) |
| InChI Key | KYSUOGUUHDNDJO-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1C2=C(C=CC=N2)C#N)C(=O)NC3=CC=C(C=C3)OCC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 1-Piperazinecarboxamide, 4-(3-cyano-2-pyridinyl)-N-[4-(phenylmethoxy)phenyl]- |