Systematic / IUPAC Name: 2-[(5-Phenyl-1H-pyrazol-4-yl)methyl]-3,4-dihydro-1H-isoquinoline
ID: Reference5988
Other Names: Isoquinoline, 1,2,3,4-tetrahydro-2-[(5-phenyl-1H-pyrazol-4-yl)methyl]-
Formula: C19H19N3
2-[(3-Phenyl-1H-pyrazol-4-yl)methyl]-1,2,3,4-tetrahydroisoquinoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/15/2016 10:39:06 AM |
| InChI | InChI=1S/C19H19N3/c1-2-7-16(8-3-1)19-18(12-20-21-19)14-22-11-10-15-6-4-5-9-17(15)13-22/h1-9,12H,10-11,13-14H2,(H,20,21) |
| InChI Key | WKSSKRDWXMSGDH-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CC2=CC=CC=C21)CC3=C(NN=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | Isoquinoline, 1,2,3,4-tetrahydro-2-[(5-phenyl-1H-pyrazol-4-yl)methyl]- |
| ChemSpider | 2091001 |
| PubChem | 2812597 |
| ChEMBL | CHEMBL1581338 |