Systematic / IUPAC Name: 3-Aminopropanoic acid
ID: Reference599
Other Names:
3-Aminopropionic acid;
β-Aminopropionic acid;
Propanoic acid, 3-amino-;
β-Aminopropanoic acid;
Abufene
; more
Formula: C3H7NO2
Class: Endogenous Metabolites Excipients/Additives/Colorants
β-Alanine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 198 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 4/21/2017 8:19:12 AM |
| InChI | InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
| InChI Key | UCMIRNVEIXFBKS-UHFFFAOYSA-N |
| Canonical SMILES | C(CN)C(=O)O |
| CAS | 107959 |
| Splash | |
| Other Names |
3-Aminopropionic acid; β-Aminopropionic acid; Propanoic acid, 3-amino-; β-Aminopropanoic acid; Abufene; Alanine, β-; β-Ala |
| ChEBI | CHEBI:16958; CHEBI:57966 |
| HMDb | HMDB00056 |
| ChemSpider | 234 |
| PubChem | 239 |
| ChEMBL | CHEMBL297569 |
| KEGG | C00099; D07561 |
| Wikipedia | Beta-alanine |
| ChemIDPlus | 000107959; 028854764; 036321401; 016690930; 061791604 |