Systematic / IUPAC Name: Ethyl N-[(2-morpholin-4-ylphenyl)carbamothioylamino]carbamate
ID: Reference5997
Other Names: Hydrazinecarboxylic acid, 2-({[2-(4-morpholinyl)phenyl]amino}thioxomethyl), ethyl ester
Formula: C14H20N4O3S
Ethyl 2-[(2-morpholinoanilino)carbothioyl]hydrazine-1-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/16/2016 7:06:53 AM |
| InChI | InChI=1S/C14H20N4O3S/c1-2-21-14(19)17-16-13(22)15-11-5-3-4-6-12(11)18-7-9-20-10-8-18/h3-6H,2,7-10H2,1H3,(H,17,19)(H2,15,16,22) |
| InChI Key | NNXVKMBVNQMNDX-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)NNC(=S)NC1=CC=CC=C1N2CCOCC2 |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboxylic acid, 2-({[2-(4-morpholinyl)phenyl]amino}thioxomethyl), ethyl ester |