Systematic / IUPAC Name: S-(2,6-Dichlorophenyl) morpholine-4-carbothioate
ID: Reference6003
Other Names: 4-Morpholinecarbothioic acid, S-(2,6-dichlorophenyl) ester
Formula: C11H11Cl2NO2S
S-(2,6-Dichlorophenyl) morpholine-4-carbothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/16/2016 2:13:55 PM |
| InChI | InChI=1S/C11H11Cl2NO2S/c12-8-2-1-3-9(13)10(8)17-11(15)14-4-6-16-7-5-14/h1-3H,4-7H2 |
| InChI Key | FDMMAJRKUHZFPD-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C(=O)SC2=C(C=CC=C2Cl)Cl |
| CAS | |
| Splash | |
| Other Names | 4-Morpholinecarbothioic acid, S-(2,6-dichlorophenyl) ester |