Systematic / IUPAC Name: 4-{5-[(4-Nitrobenzyl)sulfanyl]-1,3,4-oxadiazol-2-yl}pyridine
ID: Reference6008
Other Names:
2-[(4-Nitrobenzyl)thio]-5-(pyridin-4-yl)-1,3,4-oxadiazole ;
4-[5-(4-Nitro-benzylsulfanyl)-[1,3,4]oxadiazol-2-yl]-pyridine;
Pyridine, 4-(5-{[(4-nitrophenyl)methyl]thio}-1,3,4-oxadiazol-2-yl)-
Formula: C14H10N4O3S
4-{5-[(4-Nitrobenzyl)sulfanyl]-1,3,4-oxadiazol-2-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/16/2016 2:36:57 PM |
| InChI | InChI=1S/C14H10N4O3S/c19-18(20)12-3-1-10(2-4-12)9-22-14-17-16-13(21-14)11-5-7-15-8-6-11/h1-8H,9H2 |
| InChI Key | UNQNIANBMFBFLI-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
2-[(4-Nitrobenzyl)thio]-5-(pyridin-4-yl)-1,3,4-oxadiazole ; 4-[5-(4-Nitro-benzylsulfanyl)-[1,3,4]oxadiazol-2-yl]-pyridine; Pyridine, 4-(5-{[(4-nitrophenyl)methyl]thio}-1,3,4-oxadiazol-2-yl)- |
| PubChem | 736365 |
| ChEMBL | CHEMBL3125369 |
| ChemSpider | 643491 |