Systematic / IUPAC Name: 1-[2-({[3-(Trifluoromethyl)benzyl]sulfonyl}methyl)-1,3-thiazol-4-yl]ethanone
ID: Reference6012
Other Names:
1-(2-{[3-(Trifluoromethyl)phenyl]methylsulfonylmethyl}-1,3-thiazol-4-yl)ethanone ;
Ethanone, 1-{2-[({[3-(trifluoromethyl)phenyl]methyl}sulfonyl)methyl]-4-thiazolyl}-
Formula: C14H12F3NO3S2
1-[2-({[3-(Trifluoromethyl)benzyl]sulfonyl}methyl)-1,3-thiazol-4-yl]ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/16/2016 2:51:22 PM |
| InChI | InChI=1S/C14H12F3NO3S2/c1-9(19)12-6-22-13(18-12)8-23(20,21)7-10-3-2-4-11(5-10)14(15,16)17/h2-6H,7-8H2,1H3 |
| InChI Key | CBBNBFUYBPUXFB-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C1=CSC(=N1)CS(=O)(=O)CC2=CC(=CC=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
1-(2-{[3-(Trifluoromethyl)phenyl]methylsulfonylmethyl}-1,3-thiazol-4-yl)ethanone ; Ethanone, 1-{2-[({[3-(trifluoromethyl)phenyl]methyl}sulfonyl)methyl]-4-thiazolyl}- |