Systematic / IUPAC Name: N'-Hydroxy-2-naphthalen-1-ylethanimidamide
ID: Reference6015
Other Names:
N-Hydroxy-2-naphthalen-1-yl-acetamidine;
2-(Naphth-1-yl)acetamide oxime
Formula: C12H12N2O
N'-Hydroxy-2-(1-naphthyl)ethanimidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/18/2016 6:23:58 AM |
| InChI | InChI=1S/C12H12N2O/c13-12(14-15)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7,15H,8H2,(H2,13,14) |
| InChI Key | NWWCOKUDFCFADE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=NO)N |
| CAS | |
| Splash | |
| Other Names |
N-Hydroxy-2-naphthalen-1-yl-acetamidine; 2-(Naphth-1-yl)acetamide oxime |
| ChemSpider | 2018680 |
| PubChem | 9580380; 5702857; 2737029 |
| ChEMBL | CHEMBL1871135 |