Systematic / IUPAC Name: N'-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-1-(methylsulfonyl)methanesulfonohydrazide
ID: Reference6023
Other Names:
Methanesulfonic acid, 1-(methylsulfonyl)-, 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazide;
N'-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-(methylsulfonyl)methanesulfonohydrazide
Formula: C8H9ClF3N3O4S2
N'-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-(methylsulfonyl)methanesulfonohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/18/2016 6:58:11 AM |
| InChI | InChI=1S/C8H9ClF3N3O4S2/c1-20(16,17)4-21(18,19)15-14-7-6(9)2-5(3-13-7)8(10,11)12/h2-3,15H,4H2,1H3,(H,13,14) |
| InChI Key | LDVDLOGFEWDJDZ-UHFFFAOYSA-N |
| Canonical SMILES | CS(=O)(=O)CS(=O)(=O)NNC1=C(C=C(C=N1)C(F)(F)F)Cl |
| CAS | |
| Splash | |
| Other Names |
Methanesulfonic acid, 1-(methylsulfonyl)-, 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]hydrazide; N'-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-(methylsulfonyl)methanesulfonohydrazide |