Systematic / IUPAC Name: N-(1-amino-4-hydroxy-3,3-dimethyl-1-oxobutan-2-yl)-1-[(4-hydroxycyclohexyl)methyl]-1H-indazole-3-carboxamide
ID: Reference6029
Other Names: ADB-CHMINACA metabolite M11
Formula: C21H30N4O4
Class: Drugs of Abuse/Illegal Drugs
MAB-CHMINACA metabolite M11 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 330 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/26/2017 7:38:01 AM |
| InChI | 1S/C21H30N4O4/c1-21(2,12-26)18(19(22)28)23-20(29)17-15-5-3-4-6-16(15)25(24-17)11-13-7-9-14(27)10-8-13/h3-6,13-14,18,26-27H,7-12H2,1-2H3,(H2,22,28)(H,23,29) |
| InChI Key | MMWWZPQJJXIPQB-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC(C(N)=O)C(C)(C)CO)C1=NN(CC2CCC(O)CC2)C3=C1C=CC=C3 |
| CAS | |
| Splash | |
| Other Names | ADB-CHMINACA metabolite M11 |