Systematic / IUPAC Name: 2-(4-Chloro-2,5-dimethoxyphenyl)-N-(3-methoxybenzyl)ethanamine
ID: Reference6048
Other Names:
4-Chloro-2,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-benzeneethanamine ;
Benzeneethanamine, 4-chloro-2,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-
Formula: C18H22ClNO3
Class: Drugs of Abuse/Illegal Drugs
25C-NB3OMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2016 11:12:22 AM |
| InChI | InChI=1S/C18H22ClNO3/c1-21-15-6-4-5-13(9-15)12-20-8-7-14-10-18(23-3)16(19)11-17(14)22-2/h4-6,9-11,20H,7-8,12H2,1-3H3 |
| InChI Key | CSLNJUOCJZCEIR-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)CNCCC2=CC(=C(C=C2OC)Cl)OC |
| CAS | |
| Splash | |
| Other Names |
4-Chloro-2,5-dimethoxy-N-[(3-methoxyphenyl)methyl]-benzeneethanamine ; Benzeneethanamine, 4-chloro-2,5-dimethoxy-N-[(3-methoxyphenyl)methyl]- |