Systematic / IUPAC Name: 1-[2-(1-Benzothiophen-3-yl)ethyl]-3-(4-chlorophenyl)thiourea
ID: Reference6049
Other Names:
N-[2-(1-Benzothiophen-3-yl)ethyl]-N'-(4-chlorophenyl)thiourea ;
Thiourea, N-(2-benzo[b]thien-3-ylethyl)-N'-(4-chlorophenyl)-
Formula: C17H15ClN2S2
N-[2-(1-Benzothiophen-3-yl)ethyl]-N'-(4-chlorophenyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2016 12:11:22 PM |
| InChI | InChI=1S/C17H15ClN2S2/c18-13-5-7-14(8-6-13)20-17(21)19-10-9-12-11-22-16-4-2-1-3-15(12)16/h1-8,11H,9-10H2,(H2,19,20,21) |
| InChI Key | OPZSZJBWLQNFNZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CS2)CCNC(=S)NC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names |
N-[2-(1-Benzothiophen-3-yl)ethyl]-N'-(4-chlorophenyl)thiourea ; Thiourea, N-(2-benzo[b]thien-3-ylethyl)-N'-(4-chlorophenyl)- |