Systematic / IUPAC Name: 1-(4-Ethylphenyl)-N-(2-methoxybenzyl)-2-propanamine
ID: Reference6053
Other Names:
N-(o-Methoxybenzyl)-4-ethylamphetamine;
Benzeneethanamine, 4-ethyl-N-[(2-methoxyphenyl)methyl]-α-methyl-;
p-EA NBOMe ;
4-Ethylamphetamine NBOMe
Formula: C19H25NO
Class: Drugs of Abuse/Illegal Drugs
4-EA-NBOMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2016 12:58:28 PM |
| InChI | InChI=1S/C19H25NO/c1-4-16-9-11-17(12-10-16)13-15(2)20-14-18-7-5-6-8-19(18)21-3/h5-12,15,20H,4,13-14H2,1-3H3 |
| InChI Key | WWWBFWRUWWKJIJ-UHFFFAOYSA-N |
| Canonical SMILES | CCc1ccc(cc1)CC(C)NCc2ccccc2OC |
| CAS | |
| Splash | |
| Other Names |
N-(o-Methoxybenzyl)-4-ethylamphetamine; Benzeneethanamine, 4-ethyl-N-[(2-methoxyphenyl)methyl]-α-methyl-; p-EA NBOMe ; 4-Ethylamphetamine NBOMe |
| ChemSpider | 52085382 |