Systematic / IUPAC Name: 1-(2,5-Dimethylphenyl)-3-(2,6-dimethylphenyl)thiourea
ID: Reference6054
Other Names:
N-(2,5-Dimethylphenyl)-N'-(2,6-dimethylphenyl)thiourea ;
Thiourea, N-(2,5-dimethylphenyl)-N'-(2,6-dimethylphenyl)-
Formula: C17H20N2S
N-(2,5-Dimethylphenyl)-N'-(2,6-dimethylphenyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/21/2016 1:51:03 PM |
| InChI | InChI=1S/C17H20N2S/c1-11-8-9-12(2)15(10-11)18-17(20)19-16-13(3)6-5-7-14(16)4/h5-10H,1-4H3,(H2,18,19,20) |
| InChI Key | ITIROEBUQUCNFY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1)C)NC(=S)NC2=C(C=CC=C2C)C |
| CAS | |
| Splash | |
| Other Names |
N-(2,5-Dimethylphenyl)-N'-(2,6-dimethylphenyl)thiourea ; Thiourea, N-(2,5-dimethylphenyl)-N'-(2,6-dimethylphenyl)- |