Systematic / IUPAC Name: 2-(2-Bromo-4-fluorophenyl)-1-(diaminomethylene)guanidine
ID: Reference6057
Other Names: Guanidine, N''-{(E)-amino[(2-bromo-4-fluorophenyl)imino]methyl}-
Formula: C8H9BrFN5
1-{[{[Amino(imino)methyl]amino}(imino)methyl]amino}-2-bromo-4-fluorobenzene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/22/2016 6:37:30 AM |
| InChI | InChI=1S/C8H9BrFN5/c9-5-3-4(10)1-2-6(5)14-8(13)15-7(11)12/h1-3H,(H6,11,12,13,14,15) |
| InChI Key | XSINWFLWLWSRES-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1F)Br)N=C(N)N=C(N)N |
| CAS | |
| Splash | |
| Other Names | Guanidine, N''-{(E)-amino[(2-bromo-4-fluorophenyl)imino]methyl}- |