Systematic / IUPAC Name: 5-[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]-1,3,4-oxadiazol-2-amine
ID: Reference6058
Other Names:
5-[3-(4-Chlorophenyl)-1-phenylpyrazol-4-yl]-1,3,4-oxadiazol-2-amine;
1,3,4-Oxadiazol-2-amine, 5-[3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]-
Formula: C17H12ClN5O
5-[3-(4-Chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]-1,3,4-oxadiazol-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/22/2016 6:52:02 AM |
| InChI | InChI=1S/C17H12ClN5O/c18-12-8-6-11(7-9-12)15-14(16-20-21-17(19)24-16)10-23(22-15)13-4-2-1-3-5-13/h1-10H,(H2,19,21) |
| InChI Key | UNFDCRIDJOHUHP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)Cl)C4=NN=C(O4)N |
| CAS | |
| Splash | |
| Other Names |
5-[3-(4-Chlorophenyl)-1-phenylpyrazol-4-yl]-1,3,4-oxadiazol-2-amine; 1,3,4-Oxadiazol-2-amine, 5-[3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]- |
| ChEMBL | CHEMBL1308294 |
| ChemSpider | 2011823 |
| PubChem | 2729879 |