Systematic / IUPAC Name: 1-Allyl-N-(2-phenylethyl)cyclohexanamine
ID: Reference6060
Other Names:
(1-Allyl-cyclohexyl)-phenethyl-amine;
Benzeneethanamine, N-[1-(2-propen-1-yl)cyclohexyl]-
Formula: C17H25N
N-(1-Allylcyclohexyl)-N-phenethylamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/22/2016 7:48:36 AM |
| InChI | InChI=1S/C17H25N/c1-2-12-17(13-7-4-8-14-17)18-15-11-16-9-5-3-6-10-16/h2-3,5-6,9-10,18H,1,4,7-8,11-15H2 |
| InChI Key | UMCZASJYJMNHFL-UHFFFAOYSA-N |
| Canonical SMILES | C=CCC1(CCCCC1)NCCC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names |
(1-Allyl-cyclohexyl)-phenethyl-amine; Benzeneethanamine, N-[1-(2-propen-1-yl)cyclohexyl]- |