Systematic / IUPAC Name: 4-Chloro-N-{[1-(dimethylamino)cyclohexyl]methyl}benzamide
ID: Reference6064
Other Names: Benzamide, 4-chloro-N-{[1-(dimethylamino)cyclohexyl]methyl}-
Formula: C16H23ClN2O
Class: Drugs of Abuse/Illegal Drugs
AH 8529 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/22/2016 9:23:41 AM |
| InChI | InChI=1S/C16H23ClN2O/c1-19(2)16(10-4-3-5-11-16)12-18-15(20)13-6-8-14(17)9-7-13/h6-9H,3-5,10-12H2,1-2H3,(H,18,20) |
| InChI Key | NROYLFLWMSYSMA-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1(CCCCC1)CNC(=O)C2=CC=C(C=C2)Cl |
| CAS | 41805009 |
| Splash | |
| Other Names | Benzamide, 4-chloro-N-{[1-(dimethylamino)cyclohexyl]methyl}- |