Systematic / IUPAC Name: 2-(4-Bromo-2,5-dimethoxyphenyl)-N-(4-methoxybenzyl)ethanamine
ID: Reference6070
Other Names:
[2-(4-Bromo-2,5-dimethoxy-phenyl)-ethyl]-(4-methoxy-benzyl)-amine;
Benzeneethanamine, 4-bromo-2,5-dimethoxy-N-[(4-methoxyphenyl)methyl]- ;
25B-NBOMe 4-methoxy isomer
Formula: C18H22BrNO3
Class: Drugs of Abuse/Illegal Drugs
25B-NB4OMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/23/2016 9:20:16 AM |
| InChI | InChI=1S/C18H22BrNO3/c1-21-15-6-4-13(5-7-15)12-20-9-8-14-10-18(23-3)16(19)11-17(14)22-2/h4-7,10-11,20H,8-9,12H2,1-3H3 |
| InChI Key | FSHVGXBAVZIZCK-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNCCC2=CC(=C(C=C2OC)Br)OC |
| CAS | |
| Splash | |
| Other Names |
[2-(4-Bromo-2,5-dimethoxy-phenyl)-ethyl]-(4-methoxy-benzyl)-amine; Benzeneethanamine, 4-bromo-2,5-dimethoxy-N-[(4-methoxyphenyl)methyl]- ; 25B-NBOMe 4-methoxy isomer |
| ChemSpider | 8560532 |
| PubChem | 10385090 |
| ChEMBL | CHEMBL60585 |