Systematic / IUPAC Name: 5-[8-(2-Sulfanylidene-3H-1,3,4-oxadiazol-5-yl)octyl]-3H-1,3,4-oxadiazole-2-thione
ID: Reference6074
Other Names:
1,3,4-Oxadiazole-2(3H)-thione, 5,5'-(1,8-octanediyl)bis-;
5-[8-(5-Sulfanylidene-4H-1,3,4-oxadiazol-2-YL)octyl]-3H-1,3,4-oxadiazole-2-thione
Formula: C12H18N4O2S2
5-[8-(5-Mercapto-1,3,4-oxadiazol-2-yl)octyl]-1,3,4-oxadiazole-2-thiol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/23/2016 2:56:11 PM |
| InChI | InChI=1S/C12H18N4O2S2/c19-11-15-13-9(17-11)7-5-3-1-2-4-6-8-10-14-16-12(20)18-10/h1-8H2,(H,15,19)(H,16,20) |
| InChI Key | JDQBDYRFPFBELI-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCCC1=NNC(=S)O1)CCCC2=NNC(=S)O2 |
| CAS | |
| Splash | |
| Other Names |
1,3,4-Oxadiazole-2(3H)-thione, 5,5'-(1,8-octanediyl)bis-; 5-[8-(5-Sulfanylidene-4H-1,3,4-oxadiazol-2-YL)octyl]-3H-1,3,4-oxadiazole-2-thione |
| ChEMBL | CHEMBL1985559 |
| PubChem | 2729454 |
| ChemSpider | 2011410 |