Systematic / IUPAC Name: 1',10a'-Dihydro-2'H-dispiro[cyclohexane-1,3'-pyrimido[1,2-a]indole-10',2''-[1,3]dioxolane]
ID: Reference6087
Other Names:
5H-Pyrimido[1,2-a]indole, 1,2,3,4(4ah)-tetrahydro-2,2-pentamethylene-5,5-ethylenedioxy-;
Dispiro[cyclohexane-1,3'(4'H)-pyrimido[1,2-a]indole-10'(2'H),2''-[1,3]dioxolane], 1',10'a-dihydro-
Formula: C18H24N2O2
3-(Spirocyclohexyl)-1,2,3,4,10,11a-hexahydropyrimidino[1,2-a]indole-10-one ethylene ketal mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/24/2016 3:58:43 PM |
| InChI | InChI=1S/C18H24N2O2/c1-4-8-17(9-5-1)12-19-16-18(21-10-11-22-18)14-6-2-3-7-15(14)20(16)13-17/h2-3,6-7,16,19H,1,4-5,8-13H2 |
| InChI Key | CLGWYEIHVYRXAM-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC2(CC1)CNC3C4(C5=CC=CC=C5N3C2)OCCO4 |
| CAS | |
| Splash | |
| Other Names |
5H-Pyrimido[1,2-a]indole, 1,2,3,4(4ah)-tetrahydro-2,2-pentamethylene-5,5-ethylenedioxy-; Dispiro[cyclohexane-1,3'(4'H)-pyrimido[1,2-a]indole-10'(2'H),2''-[1,3]dioxolane], 1',10'a-dihydro- |