Systematic / IUPAC Name: 2-[(5-{[(1-Naphthylmethyl)sulfanyl]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-3-nitropyridine
ID: Reference6089
Other Names: Pyridine, 2-[(5-{[(1-naphthalenylmethyl)thio]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)thio]-3-nitro-
Formula: C25H19N5O2S2
2-[(5-{[(1-Naphthylmethyl)thio]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)thio]-3-nitropyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/25/2016 6:39:09 AM |
| InChI | InChI=1S/C25H19N5O2S2/c31-30(32)22-14-7-15-26-24(22)34-25-28-27-23(29(25)20-11-2-1-3-12-20)17-33-16-19-10-6-9-18-8-4-5-13-21(18)19/h1-15H,16-17H2 |
| InChI Key | MEKLFALEPGYITD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)N2C(=NN=C2SC3=C(C=CC=N3)[N+](=O)[O-])CSCC4=CC=CC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names | Pyridine, 2-[(5-{[(1-naphthalenylmethyl)thio]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)thio]-3-nitro- |