Systematic / IUPAC Name: Ethyl 3,3,3-trifluoro-2-hydroxy-2-{4-[(methylcarbamoyl)amino]phenyl}propanoate
ID: Reference6094
Other Names:
Benzeneacetic acid, α-hydroxy-4-{[(methylamino)carbonyl]amino}-α-(trifluoromethyl)-, ethyl ester ;
Ethyl 3,3,3-trifluoro-2-hydroxy-2-[4-(methylcarbamoylamino)phenyl]propanoate
Formula: C13H15F3N2O4
Ethyl 3,3,3-trifluoro-2-hydroxy-2-(4-{[(methylamino)carbonyl]amino}phenyl)propanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/25/2016 8:33:56 AM |
| InChI | InChI=1S/C13H15F3N2O4/c1-3-22-10(19)12(21,13(14,15)16)8-4-6-9(7-5-8)18-11(20)17-2/h4-7,21H,3H2,1-2H3,(H2,17,18,20) |
| InChI Key | YXSRHMQVPZUUSH-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(C1=CC=C(C=C1)NC(=O)NC)(C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
Benzeneacetic acid, α-hydroxy-4-{[(methylamino)carbonyl]amino}-α-(trifluoromethyl)-, ethyl ester ; Ethyl 3,3,3-trifluoro-2-hydroxy-2-[4-(methylcarbamoylamino)phenyl]propanoate |
| ChEMBL | CHEMBL1711076 |
| PubChem | 2817827 |
| ChemSpider | 2096115 |