Systematic / IUPAC Name: N'-[(3,5-Dichloro-2,6-dimethoxybenzoyl)oxy]-5-nitro-2-furancarboximidamide
ID: Reference6097
Other Names: 2-Furancarboximidamide, N'-[(3,5-dichloro-2,6-dimethoxybenzoyl)oxy]-5-nitro-
Formula: C14H11Cl2N3O7
N'-[(3,5-Dichloro-2,6-dimethoxybenzoyl)oxy]-5-nitrofuran-2-carboximidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/25/2016 10:31:40 AM |
| InChI | InChI=1S/C14H11Cl2N3O7/c1-23-11-6(15)5-7(16)12(24-2)10(11)14(20)26-18-13(17)8-3-4-9(25-8)19(21)22/h3-5H,1-2H3,(H2,17,18) |
| InChI Key | LFUAXBLCUVVLFT-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Furancarboximidamide, N'-[(3,5-dichloro-2,6-dimethoxybenzoyl)oxy]-5-nitro- |