Systematic / IUPAC Name: 2-[(4-Chlorobenzyl)sulfanyl]-N-(4-fluorophenyl)acetamide
ID: Reference6118
Other Names: Acetamide, 2-{[(4-chlorophenyl)methyl]thio}-N-(4-fluorophenyl)-
Formula: C15H13ClFNOS
N1-(4-Fluorophenyl)-2-[(4-chlorobenzyl)thio]acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/28/2016 1:26:06 PM |
| InChI | InChI=1S/C15H13ClFNOS/c16-12-3-1-11(2-4-12)9-20-10-15(19)18-14-7-5-13(17)6-8-14/h1-8H,9-10H2,(H,18,19) |
| InChI Key | HAHBASMBZNQKBF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CSCC(=O)NC2=CC=C(C=C2)F)Cl |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-{[(4-chlorophenyl)methyl]thio}-N-(4-fluorophenyl)- |